ChemNet > CAS > 96449-68-2 1- (4-fluorobenzyl) -5-okso-3-asam pirolidinakarboksilat
96449-68-2 1- (4-fluorobenzyl) -5-okso-3-asam pirolidinakarboksilat
| Nama produk |
1- (4-fluorobenzyl) -5-okso-3-asam pirolidinakarboksilat |
| Sinonim |
1- (4-fluorobenzyl) -5-oksopirolidin-3-asam karboksilat |
| Nama bahasa Inggris |
1-(4-fluorobenzyl)-5-oxo-3-pyrrolidinecarboxylic acid;1-(4-fluorobenzyl)-5-oxopyrrolidine-3-carboxylic acid |
| MF |
C12H12FNO3 |
| Berat Molekul |
237.227 |
| InChI |
InChI=1/C12H12FNO3/c13-10-3-1-8(2-4-10)6-14-7-9(12(16)17)5-11(14)15/h1-4,9H,5-7H2,(H,16,17) |
| CAS NO |
96449-68-2 |
| Struktur Molekul |
|
| Kepadatan |
1.387g/cm3 |
| Titik lebur |
149℃ |
| Titik didih |
476.2°C at 760 mmHg |
| Indeks bias |
1.586 |
| Titik nyala |
241.8°C |
| Tekanan uap |
7.12E-10mmHg at 25°C |
| Simbol bahaya |
Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|